C16H18ClN5O3 — CID 120937395
(3R,4S)-N-[(2-chloro-5-nitrophenyl)methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 120937395) has the molecular formula C16H18ClN5O3 and a molecular weight of 363.81 g/mol. Its IUPAC name is (3R,4S)-N-[(2-chloro-5-nitrophenyl)methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[(2-chloro-5-nitrophenyl)methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120937395 |
| Molecular Formula | C16H18ClN5O3 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3R,4S)-N-[(2-chloro-5-nitrophenyl)methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | Cn1cc([C@H]2CNC[C@@H]2C(=O)NCc2cc([N+](=O)[O-])ccc2Cl)cn1 |
| InChI | InChI=1S/C16H18ClN5O3/c1-21-9-11(6-20-21)13-7-18-8-14(13)16(23)19-5-10-4-12(22(24)25)2-3-15(10)17/h2-4,6,9,13-14,18H,5,7-8H2,1H3,(H,19,23)/t13-,14+/m1/s1 |
| InChIKey | UOICJGVGUSHQNX-KGLIPLIRSA-N |
| XLogP | 1.60 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|