About 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine
5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine (PubChem CID 154810266) has the molecular formula C18H22N6O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine.
Molecular Properties
| Compound Name | 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine |
| PubChem CID | 154810266 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine |
| SMILES | CN1CCN(c2cccc([N+](=O)[O-])c2)CC1.Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H15N3O2.C7H7N3O/c1-12-5-7-13(8-6-12)10-3-2-4-11(9-10)14(15)16;8-4-1-2-5-6(3-4)10-7(11)9-5/h2-4,9H,5-8H2,1H3;1-3H,8H2,(H2,9,10,11) |
| InChIKey | BYTARZOXEPWXBZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine?
The IUPAC name of 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine (CID 154810266) is 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine.
What is the SMILES notation for 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine?
The canonical SMILES for 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine is CN1CCN(c2cccc([N+](=O)[O-])c2)CC1.Nc1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine?
The InChIKey is BYTARZOXEPWXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2.C7H7N3O/c1-12-5-7-13(8-6-12)10-3-2-4-11(9-10)14(15)16;8-4-1-2-5-6(3-4)10-7(11)9-5/h2-4,9H,5-8H2,1H3;1-3H,8H2,(H2,9,10,11).
What are the key properties of 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine?
5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine has a molecular weight of 370.41 g/mol, XLogP of 1.78, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-dihydrobenzimidazol-2-one;1-methyl-4-(3-nitrophenyl)piperazine is sourced from PubChem (CID 154810266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).