C25H33FN4O3 — CID 177199474
benzyl 4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 177199474) has the molecular formula C25H33FN4O3 and a molecular weight of 456.56 g/mol. Its IUPAC name is benzyl 4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177199474 |
| Molecular Formula | C25H33FN4O3 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | benzyl 4-[[4-(4-amino-2-fluoro-5-methoxyphenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | COc1cc(N2CCN(CC3CCN(C(=O)OCc4ccccc4)CC3)CC2)c(F)cc1N |
| InChI | InChI=1S/C25H33FN4O3/c1-32-24-16-23(21(26)15-22(24)27)29-13-11-28(12-14-29)17-19-7-9-30(10-8-19)25(31)33-18-20-5-3-2-4-6-20/h2-6,15-16,19H,7-14,17-18,27H2,1H3 |
| InChIKey | BWSFHSYLNTZIMV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|