C26H24N2O5S — CID 139253605
(2S)-2,4-dibenzyl-5-methyl-1-(4-nitrophenyl)sulfonyl-2,4-dihydropyridin-3-one (PubChem CID 139253605) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is (2S)-2,4-dibenzyl-5-methyl-1-(4-nitrophenyl)sulfonyl-2,4-dihydropyridin-3-one.
| Compound Name | (2S)-2,4-dibenzyl-5-methyl-1-(4-nitrophenyl)sulfonyl-2,4-dihydropyridin-3-one |
|---|---|
| PubChem CID | 139253605 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (2S)-2,4-dibenzyl-5-methyl-1-(4-nitrophenyl)sulfonyl-2,4-dihydropyridin-3-one |
| SMILES | CC1=CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](Cc2ccccc2)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C26H24N2O5S/c1-19-18-27(34(32,33)23-14-12-22(13-15-23)28(30)31)25(17-21-10-6-3-7-11-21)26(29)24(19)16-20-8-4-2-5-9-20/h2-15,18,24-25H,16-17H2,1H3/t24?,25-/m0/s1 |
| InChIKey | CGDVTADRUUKILT-BBMPLOMVSA-N |
| XLogP | 4.54 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|