C25H22N2O7S — CID 158923497
6-methyl-1-(4-nitrophenyl)sulfonyl-3-phenyl-5a,6,7,9,9a,9b-hexahydro-3aH-benzo[g]indole-4,5,8-trione (PubChem CID 158923497) has the molecular formula C25H22N2O7S and a molecular weight of 494.53 g/mol. Its IUPAC name is 6-methyl-1-(4-nitrophenyl)sulfonyl-3-phenyl-5a,6,7,9,9a,9b-hexahydro-3aH-benzo[g]indole-4,5,8-trione.
| Compound Name | 6-methyl-1-(4-nitrophenyl)sulfonyl-3-phenyl-5a,6,7,9,9a,9b-hexahydro-3aH-benzo[g]indole-4,5,8-trione |
|---|---|
| PubChem CID | 158923497 |
| Molecular Formula | C25H22N2O7S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 6-methyl-1-(4-nitrophenyl)sulfonyl-3-phenyl-5a,6,7,9,9a,9b-hexahydro-3aH-benzo[g]indole-4,5,8-trione |
| SMILES | CC1CC(=O)CC2C1C(=O)C(=O)C1C(c3ccccc3)=CN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C12 |
| InChI | InChI=1S/C25H22N2O7S/c1-14-11-17(28)12-19-21(14)24(29)25(30)22-20(15-5-3-2-4-6-15)13-26(23(19)22)35(33,34)18-9-7-16(8-10-18)27(31)32/h2-10,13-14,19,21-23H,11-12H2,1H3 |
| InChIKey | RCKBIRSESVRJKA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|