C21H18N2O7S — CID 102335486
(5S,10S)-7-(4-nitrophenyl)sulfonyl-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione (PubChem CID 102335486) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is (5S,10S)-7-(4-nitrophenyl)sulfonyl-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione.
| Compound Name | (5S,10S)-7-(4-nitrophenyl)sulfonyl-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione |
|---|---|
| PubChem CID | 102335486 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (5S,10S)-7-(4-nitrophenyl)sulfonyl-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@]2(CCCC2=O)C(=O)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N2O7S/c24-18-7-4-12-21(18)17(14-5-2-1-3-6-14)13-19(25)22(20(21)26)31(29,30)16-10-8-15(9-11-16)23(27)28/h1-3,5-6,8-11,17H,4,7,12-13H2/t17-,21-/m0/s1 |
| InChIKey | ZLTNLGKQEILFEX-UWJYYQICSA-N |
| XLogP | 2.57 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|