C21H17ClN2O7S — CID 102335489
(5S,10S)-10-(3-chlorophenyl)-7-(4-nitrophenyl)sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione (PubChem CID 102335489) has the molecular formula C21H17ClN2O7S and a molecular weight of 476.89 g/mol. Its IUPAC name is (5S,10S)-10-(3-chlorophenyl)-7-(4-nitrophenyl)sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione.
| Compound Name | (5S,10S)-10-(3-chlorophenyl)-7-(4-nitrophenyl)sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione |
|---|---|
| PubChem CID | 102335489 |
| Molecular Formula | C21H17ClN2O7S |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | (5S,10S)-10-(3-chlorophenyl)-7-(4-nitrophenyl)sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione |
| SMILES | O=C1C[C@@H](c2cccc(Cl)c2)[C@]2(CCCC2=O)C(=O)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17ClN2O7S/c22-14-4-1-3-13(11-14)17-12-19(26)23(20(27)21(17)10-2-5-18(21)25)32(30,31)16-8-6-15(7-9-16)24(28)29/h1,3-4,6-9,11,17H,2,5,10,12H2/t17-,21-/m0/s1 |
| InChIKey | KUCIPJGGMQLGJI-UWJYYQICSA-N |
| XLogP | 3.22 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|