C17H16BrClN2O4S — CID 135058790
(2R,3S)-3-bromo-2-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonylpiperidine (PubChem CID 135058790) has the molecular formula C17H16BrClN2O4S and a molecular weight of 459.75 g/mol. Its IUPAC name is (2R,3S)-3-bromo-2-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonylpiperidine.
| Compound Name | (2R,3S)-3-bromo-2-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 135058790 |
| Molecular Formula | C17H16BrClN2O4S |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | (2R,3S)-3-bromo-2-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonylpiperidine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC[C@H](Br)[C@H]2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16BrClN2O4S/c18-16-5-2-10-20(17(16)12-3-1-4-13(19)11-12)26(24,25)15-8-6-14(7-9-15)21(22)23/h1,3-4,6-9,11,16-17H,2,5,10H2/t16-,17+/m0/s1 |
| InChIKey | BHHGIUOCJLLRNJ-DLBZAZTESA-N |
| XLogP | 4.54 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|