C17H13ClN4O4S — CID 71613858
5-amino-3-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonyl-2,3-dihydropyrrole-4-carbonitrile (PubChem CID 71613858) has the molecular formula C17H13ClN4O4S and a molecular weight of 404.84 g/mol. Its IUPAC name is 5-amino-3-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonyl-2,3-dihydropyrrole-4-carbonitrile.
| Compound Name | 5-amino-3-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonyl-2,3-dihydropyrrole-4-carbonitrile |
|---|---|
| PubChem CID | 71613858 |
| Molecular Formula | C17H13ClN4O4S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 5-amino-3-(3-chlorophenyl)-1-(4-nitrophenyl)sulfonyl-2,3-dihydropyrrole-4-carbonitrile |
| SMILES | N#CC1=C(N)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13ClN4O4S/c18-12-3-1-2-11(8-12)16-10-21(17(20)15(16)9-19)27(25,26)14-6-4-13(5-7-14)22(23)24/h1-8,16H,10,20H2 |
| InChIKey | XSXCTOPSTVLNDB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|