C22H18F3NO5S — CID 102335494
(5S,10S)-10-phenyl-7-[4-(trifluoromethyl)phenyl]sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione (PubChem CID 102335494) has the molecular formula C22H18F3NO5S and a molecular weight of 465.45 g/mol. Its IUPAC name is (5S,10S)-10-phenyl-7-[4-(trifluoromethyl)phenyl]sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione.
| Compound Name | (5S,10S)-10-phenyl-7-[4-(trifluoromethyl)phenyl]sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione |
|---|---|
| PubChem CID | 102335494 |
| Molecular Formula | C22H18F3NO5S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | (5S,10S)-10-phenyl-7-[4-(trifluoromethyl)phenyl]sulfonyl-7-azaspiro[4.5]decane-4,6,8-trione |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@]2(CCCC2=O)C(=O)N1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3NO5S/c23-22(24,25)15-8-10-16(11-9-15)32(30,31)26-19(28)13-17(14-5-2-1-3-6-14)21(20(26)29)12-4-7-18(21)27/h1-3,5-6,8-11,17H,4,7,12-13H2/t17-,21-/m0/s1 |
| InChIKey | JFVPHKNDXOEMPU-UWJYYQICSA-N |
| XLogP | 3.68 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|