C23H17F6NO3 — CID 102335484
(5S,10S)-7-[3,5-bis(trifluoromethyl)phenyl]-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione (PubChem CID 102335484) has the molecular formula C23H17F6NO3 and a molecular weight of 469.38 g/mol. Its IUPAC name is (5S,10S)-7-[3,5-bis(trifluoromethyl)phenyl]-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione.
| Compound Name | (5S,10S)-7-[3,5-bis(trifluoromethyl)phenyl]-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione |
|---|---|
| PubChem CID | 102335484 |
| Molecular Formula | C23H17F6NO3 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (5S,10S)-7-[3,5-bis(trifluoromethyl)phenyl]-10-phenyl-7-azaspiro[4.5]decane-4,6,8-trione |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@]2(CCCC2=O)C(=O)N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F6NO3/c24-22(25,26)14-9-15(23(27,28)29)11-16(10-14)30-19(32)12-17(13-5-2-1-3-6-13)21(20(30)33)8-4-7-18(21)31/h1-3,5-6,9-11,17H,4,7-8,12H2/t17-,21-/m0/s1 |
| InChIKey | XSOHTFMWYIUKOC-UWJYYQICSA-N |
| XLogP | 5.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|