C35H34N2O11S3 — CID 99653459
[(2R)-2-[(4S,5R)-5-[bis(benzylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrophenyl)sulfonyloxyethyl] 4-nitrobenzoate (PubChem CID 99653459) has the molecular formula C35H34N2O11S3 and a molecular weight of 754.86 g/mol. Its IUPAC name is [(2R)-2-[(4S,5R)-5-[bis(benzylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrophenyl)sulfonyloxyethyl] 4-nitrobenzoate.
| Compound Name | [(2R)-2-[(4S,5R)-5-[bis(benzylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrophenyl)sulfonyloxyethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 99653459 |
| Molecular Formula | C35H34N2O11S3 |
| Molecular Weight | 754.86 g/mol |
| Exact Mass | 754.13 |
| IUPAC Name | [(2R)-2-[(4S,5R)-5-[bis(benzylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-nitrophenyl)sulfonyloxyethyl] 4-nitrobenzoate |
| SMILES | CC1(C)O[C@H]([C@@H](COC(=O)c2ccc([N+](=O)[O-])cc2)OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H](C(SCc2ccccc2)SCc2ccccc2)O1 |
| InChI | InChI=1S/C35H34N2O11S3/c1-35(2)46-31(32(47-35)34(49-22-24-9-5-3-6-10-24)50-23-25-11-7-4-8-12-25)30(21-45-33(38)26-13-15-27(16-14-26)36(39)40)48-51(43,44)29-19-17-28(18-20-29)37(41)42/h3-20,30-32,34H,21-23H2,1-2H3/t30-,31-,32-/m1/s1 |
| InChIKey | JFSLVGVNRPCWBQ-XWHIBYANSA-N |
| XLogP | 7.15 |
| TPSA | 174.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.86 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|