C30H38O6 — CID 58304993
2-[(E)-3-[(4S,5R)-5-[(Z,5S)-4-benzyl-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoic acid (PubChem CID 58304993) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-[(E)-3-[(4S,5R)-5-[(Z,5S)-4-benzyl-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoic acid.
| Compound Name | 2-[(E)-3-[(4S,5R)-5-[(Z,5S)-4-benzyl-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 58304993 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-[(E)-3-[(4S,5R)-5-[(Z,5S)-4-benzyl-1,5-dihydroxyhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-4,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2C(O)/C=C\C(Cc2ccccc2)[C@H](C)O)c1 |
| InChI | InChI=1S/C30H38O6/c1-19-16-20(2)27(29(33)34)24(17-19)12-9-13-26-28(36-30(4,5)35-26)25(32)15-14-23(21(3)31)18-22-10-7-6-8-11-22/h6-12,14-17,21,23,25-26,28,31-32H,13,18H2,1-5H3,(H,33,34)/b12-9+,15-14-/t21-,23?,25?,26-,28+/m0/s1 |
| InChIKey | XYPXIJIGHWPHMP-FRAZOLSOSA-N |
| XLogP | 5.08 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|