C24H35NO9 — CID 91393490
2-[[2-[(4S,5R)-5-[(6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetyl]amino]-4-methoxy-6-(methoxymethoxy)benzoic acid (PubChem CID 91393490) has the molecular formula C24H35NO9 and a molecular weight of 481.54 g/mol. Its IUPAC name is 2-[[2-[(4S,5R)-5-[(6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetyl]amino]-4-methoxy-6-(methoxymethoxy)benzoic acid.
| Compound Name | 2-[[2-[(4S,5R)-5-[(6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetyl]amino]-4-methoxy-6-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 91393490 |
| Molecular Formula | C24H35NO9 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[[2-[(4S,5R)-5-[(6R)-6-hydroxyhept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetyl]amino]-4-methoxy-6-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1cc(OC)cc(NC(=O)C[C@@H]2OC(C)(C)O[C@@H]2C(C)C=CC[C@@H](C)O)c1C(=O)O |
| InChI | InChI=1S/C24H35NO9/c1-14(8-7-9-15(2)26)22-19(33-24(3,4)34-22)12-20(27)25-17-10-16(31-6)11-18(32-13-30-5)21(17)23(28)29/h7-8,10-11,14-15,19,22,26H,9,12-13H2,1-6H3,(H,25,27)(H,28,29)/t14?,15-,19+,22-/m1/s1 |
| InChIKey | ATCRFNGLXBMJJR-KKQDSYPPSA-N |
| XLogP | 3.19 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|