C27H44O6Si — CID 58305042
2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z)-1,5-dihydroxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate (PubChem CID 58305042) has the molecular formula C27H44O6Si and a molecular weight of 492.73 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z)-1,5-dihydroxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate.
| Compound Name | 2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z)-1,5-dihydroxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 58305042 |
| Molecular Formula | C27H44O6Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 2-trimethylsilylethyl 2-[3-[(4S)-5-[(Z)-1,5-dihydroxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propyl]-4,6-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC[Si](C)(C)C)c(CCC[C@@H]2OC(C)(C)OC2C(O)/C=C\CCO)c1 |
| InChI | InChI=1S/C27H44O6Si/c1-19-17-20(2)24(26(30)31-15-16-34(5,6)7)21(18-19)11-10-13-23-25(33-27(3,4)32-23)22(29)12-8-9-14-28/h8,12,17-18,22-23,25,28-29H,9-11,13-16H2,1-7H3/b12-8-/t22?,23-,25?/m0/s1 |
| InChIKey | AJZWZBFMLTTWJQ-NMSACHEUSA-N |
| XLogP | 4.94 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|