C41H54Br2O6Si — CID 11600334
(2S,6R,7S)-9,9-dibromo-1-[(2R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]-2-hydroxy-6-[(4-methoxyphenyl)methoxy]-7-methylnon-8-en-4-one (PubChem CID 11600334) has the molecular formula C41H54Br2O6Si and a molecular weight of 830.77 g/mol. Its IUPAC name is (2S,6R,7S)-9,9-dibromo-1-[(2R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]-2-hydroxy-6-[(4-methoxyphenyl)methoxy]-7-methylnon-8-en-4-one.
| Compound Name | (2S,6R,7S)-9,9-dibromo-1-[(2R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]-2-hydroxy-6-[(4-methoxyphenyl)methoxy]-7-methylnon-8-en-4-one |
|---|---|
| PubChem CID | 11600334 |
| Molecular Formula | C41H54Br2O6Si |
| Molecular Weight | 830.77 g/mol |
| Exact Mass | 828.21 |
| IUPAC Name | (2S,6R,7S)-9,9-dibromo-1-[(2R,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxan-2-yl]-2-hydroxy-6-[(4-methoxyphenyl)methoxy]-7-methylnon-8-en-4-one |
| SMILES | COc1ccc(CO[C@H](CC(=O)C[C@@H](O)C[C@H]2CCC[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)[C@@H](C)C=C(Br)Br)cc1 |
| InChI | InChI=1S/C41H54Br2O6Si/c1-30(25-40(42)43)39(47-29-31-19-21-34(46-5)22-20-31)28-33(45)26-32(44)27-36-14-12-13-35(49-36)23-24-48-50(41(2,3)4,37-15-8-6-9-16-37)38-17-10-7-11-18-38/h6-11,15-22,25,30,32,35-36,39,44H,12-14,23-24,26-29H2,1-5H3/t30-,32+,35+,36+,39+/m0/s1 |
| InChIKey | PKSKBESSFWDODT-OPOLDFOZSA-N |
| XLogP | 8.85 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.77 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|