C16H24O6S — CID 102244812
(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-5-[hydroxy(thiophen-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 102244812) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-5-[hydroxy(thiophen-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-5-[hydroxy(thiophen-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 102244812 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-5-[hydroxy(thiophen-2-yl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)O[C@@H]([C@H](O)[C@H]2COC(C)(C)O2)[C@@H](C(O)c2cccs2)O1 |
| InChI | InChI=1S/C16H24O6S/c1-15(2)19-8-9(20-15)11(17)13-14(22-16(3,4)21-13)12(18)10-6-5-7-23-10/h5-7,9,11-14,17-18H,8H2,1-4H3/t9-,11-,12?,13+,14-/m1/s1 |
| InChIKey | RISCRAMLCUILDQ-PRKRQFAPSA-N |
| XLogP | 1.81 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |