C18H38O3Sn — CID 11166077
(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tributylstannylmethanol (PubChem CID 11166077) has the molecular formula C18H38O3Sn and a molecular weight of 421.21 g/mol. Its IUPAC name is (S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tributylstannylmethanol.
| Compound Name | (S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tributylstannylmethanol |
|---|---|
| PubChem CID | 11166077 |
| Molecular Formula | C18H38O3Sn |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-tributylstannylmethanol |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C6H11O3.3C4H9.Sn/c1-6(2)8-4-5(3-7)9-6;3*1-3-4-2;/h3,5,7H,4H2,1-2H3;3*1,3-4H2,2H3;/t5-;;;;/m0..../s1 |
| InChIKey | UUSMPPIZERGBAP-OUTKXMMCSA-N |
| XLogP | 4.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |