C6H11Cl2O3PS — CID 14699861
dichloro-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-sulfanylidene-lambda5-phosphane (PubChem CID 14699861) has the molecular formula C6H11Cl2O3PS and a molecular weight of 265.10 g/mol. Its IUPAC name is dichloro-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-sulfanylidene-lambda5-phosphane.
| Compound Name | dichloro-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 14699861 |
| Molecular Formula | C6H11Cl2O3PS |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | dichloro-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-sulfanylidene-lambda5-phosphane |
| SMILES | CC1(C)OCC(COP(=S)(Cl)Cl)O1 |
| InChI | InChI=1S/C6H11Cl2O3PS/c1-6(2)9-3-5(11-6)4-10-12(7,8)13/h5H,3-4H2,1-2H3 |
| InChIKey | FBGWHNAEYVQEOJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|