C12H26NO6P — CID 23273251
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(trimethylazaniumyl)propyl phosphate (PubChem CID 23273251) has the molecular formula C12H26NO6P and a molecular weight of 311.32 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(trimethylazaniumyl)propyl phosphate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(trimethylazaniumyl)propyl phosphate |
|---|---|
| PubChem CID | 23273251 |
| Molecular Formula | C12H26NO6P |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(trimethylazaniumyl)propyl phosphate |
| SMILES | CC1(C)OCC(COP(=O)([O-])OCCC[N+](C)(C)C)O1 |
| InChI | InChI=1S/C12H26NO6P/c1-12(2)16-9-11(19-12)10-18-20(14,15)17-8-6-7-13(3,4)5/h11H,6-10H2,1-5H3 |
| InChIKey | CAWNYADAWUNJCD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|