C28H44N2O12P2 — CID 135012136
[(2R,13R)-13-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,11,14-tetraoxacycloicosa-6,8,16,18-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 135012136) has the molecular formula C28H44N2O12P2 and a molecular weight of 662.61 g/mol. Its IUPAC name is [(2R,13R)-13-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,11,14-tetraoxacycloicosa-6,8,16,18-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R,13R)-13-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,11,14-tetraoxacycloicosa-6,8,16,18-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 135012136 |
| Molecular Formula | C28H44N2O12P2 |
| Molecular Weight | 662.61 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | [(2R,13R)-13-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,11,14-tetraoxacycloicosa-6,8,16,18-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@H]1COCC#CC#CCOC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OCC#CC#CCO1 |
| InChI | InChI=1S/C28H44N2O12P2/c1-29(2,3)15-21-39-43(31,32)41-25-27-23-35-17-11-7-8-12-18-36-24-28(38-20-14-10-9-13-19-37-27)26-42-44(33,34)40-22-16-30(4,5)6/h27-28H,15-26H2,1-6H3/t27-,28-/m1/s1 |
| InChIKey | WSDLOJUACYDAFH-VSGBNLITSA-N |
| XLogP | -0.77 |
| TPSA | 154.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.61 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|