C48H84N2O12P2 — CID 10865940
[23-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,21,24-tetraoxacyclotetraconta-11,13,31,33-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 10865940) has the molecular formula C48H84N2O12P2 and a molecular weight of 943.15 g/mol. Its IUPAC name is [23-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,21,24-tetraoxacyclotetraconta-11,13,31,33-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [23-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,21,24-tetraoxacyclotetraconta-11,13,31,33-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 10865940 |
| Molecular Formula | C48H84N2O12P2 |
| Molecular Weight | 943.15 g/mol |
| Exact Mass | 942.55 |
| IUPAC Name | [23-[[oxido-[2-(trimethylazaniumyl)ethoxy]phosphoryl]oxymethyl]-1,4,21,24-tetraoxacyclotetraconta-11,13,31,33-tetrayn-2-yl]methyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCC1COCCCCCCC#CC#CCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OCCCCCCC#CC#CCCCCCCO1 |
| InChI | InChI=1S/C48H84N2O12P2/c1-49(2,3)35-41-59-63(51,52)61-45-47-43-55-37-31-27-23-19-15-11-7-8-12-16-20-24-28-32-38-56-44-48(46-62-64(53,54)60-42-36-50(4,5)6)58-40-34-30-26-22-18-14-10-9-13-17-21-25-29-33-39-57-47/h47-48H,15-46H2,1-6H3 |
| InChIKey | ZVYCBJYGNBNERU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 154.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.15 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|