C21H23F2O6P — CID 10939096
2-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoroethanone (PubChem CID 10939096) has the molecular formula C21H23F2O6P and a molecular weight of 440.38 g/mol. Its IUPAC name is 2-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoroethanone.
| Compound Name | 2-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 10939096 |
| Molecular Formula | C21H23F2O6P |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-bis(phenylmethoxy)phosphoryl-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoroethanone |
| SMILES | CC1(C)OC[C@H](C(=O)C(F)(F)P(=O)(OCc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C21H23F2O6P/c1-20(2)26-15-18(29-20)19(24)21(22,23)30(25,27-13-16-9-5-3-6-10-16)28-14-17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | JCZVUIRRHXAFAU-GOSISDBHSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|