C9H12O5 — CID 176987108
(4-methoxy-6-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)methyl acetate (PubChem CID 176987108) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (4-methoxy-6-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)methyl acetate.
| Compound Name | (4-methoxy-6-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 176987108 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (4-methoxy-6-oxo-3-oxabicyclo[3.1.0]hexan-2-yl)methyl acetate |
| SMILES | COC1OC(COC(C)=O)C2C(=O)C12 |
| InChI | InChI=1S/C9H12O5/c1-4(10)13-3-5-6-7(8(6)11)9(12-2)14-5/h5-7,9H,3H2,1-2H3 |
| InChIKey | XLQOZXOGENFCPY-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |