C10H17NO2 — CID 117274933
(4-amino-10-oxatricyclo[5.2.1.02,6]decan-4-yl)methanol (PubChem CID 117274933) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (4-amino-10-oxatricyclo[5.2.1.02,6]decan-4-yl)methanol.
| Compound Name | (4-amino-10-oxatricyclo[5.2.1.02,6]decan-4-yl)methanol |
|---|---|
| PubChem CID | 117274933 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (4-amino-10-oxatricyclo[5.2.1.02,6]decan-4-yl)methanol |
| SMILES | NC1(CO)CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C10H17NO2/c11-10(5-12)3-6-7(4-10)9-2-1-8(6)13-9/h6-9,12H,1-5,11H2 |
| InChIKey | IOBIJLSEYKRSOD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |