C11H10N2O3 — CID 10608842
(1S,3R,4R,6S,7S,9R,10R,11R)-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane-3,7-dicarbonitrile (PubChem CID 10608842) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is (1S,3R,4R,6S,7S,9R,10R,11R)-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane-3,7-dicarbonitrile.
| Compound Name | (1S,3R,4R,6S,7S,9R,10R,11R)-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 10608842 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (1S,3R,4R,6S,7S,9R,10R,11R)-2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecane-3,7-dicarbonitrile |
| SMILES | N#C[C@@H]1O[C@H]2O[C@H]3O[C@H](C#N)[C@H]4C[C@@H]1[C@@H]2[C@H]34 |
| InChI | InChI=1S/C11H10N2O3/c12-2-6-4-1-5-7(3-13)15-11-9(5)8(4)10(14-6)16-11/h4-11H,1H2/t4-,5+,6-,7+,8-,9-,10-,11+/m1/s1 |
| InChIKey | XNBDAYUFNXHSQQ-GVNZCOONSA-N |
| XLogP | 0.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |