C11H16O3 — CID 10845554
(1S,3R,4S,5R,7R,9S,11S,12S)-5,11-dimethyl-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecane (PubChem CID 10845554) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,3R,4S,5R,7R,9S,11S,12S)-5,11-dimethyl-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecane.
| Compound Name | (1S,3R,4S,5R,7R,9S,11S,12S)-5,11-dimethyl-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecane |
|---|---|
| PubChem CID | 10845554 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1S,3R,4S,5R,7R,9S,11S,12S)-5,11-dimethyl-6,8,10-trioxatetracyclo[7.3.0.03,7.04,12]dodecane |
| SMILES | C[C@@H]1O[C@H]2O[C@H]3O[C@H](C)[C@@H]4[C@H]3C[C@H]2[C@H]41 |
| InChI | InChI=1S/C11H16O3/c1-4-8-6-3-7-9(8)5(2)13-11(7)14-10(6)12-4/h4-11H,3H2,1-2H3/t4-,5+,6-,7+,8-,9-,10-,11+/m1/s1 |
| InChIKey | LTQVRBNOQFTITA-GVNZCOONSA-N |
| XLogP | 1.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |