C13H16O2 — CID 126605387
(6S,13S)-5-methyl-4,12-dioxahexacyclo[7.5.0.02,7.03,6.010,14.011,13]tetradecane (PubChem CID 126605387) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (6S,13S)-5-methyl-4,12-dioxahexacyclo[7.5.0.02,7.03,6.010,14.011,13]tetradecane.
| Compound Name | (6S,13S)-5-methyl-4,12-dioxahexacyclo[7.5.0.02,7.03,6.010,14.011,13]tetradecane |
|---|---|
| PubChem CID | 126605387 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (6S,13S)-5-methyl-4,12-dioxahexacyclo[7.5.0.02,7.03,6.010,14.011,13]tetradecane |
| SMILES | CC1OC2C3C4C(CC3[C@@H]12)C1C2O[C@H]2C41 |
| InChI | InChI=1S/C13H16O2/c1-3-6-4-2-5-7(8(4)11(6)14-3)10-9(5)12-13(10)15-12/h3-13H,2H2,1H3/t3?,4?,5?,6-,7?,8?,9?,10?,11?,12?,13+/m1/s1 |
| InChIKey | QBELCMPESVIKGL-HLKDBMSPSA-N |
| XLogP | 1.30 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|