C10H10O2 — CID 99954925
(3R,4S,6R,7S,8S,9S,11S,12S)-5,10-dioxahexacyclo[6.4.0.02,7.03,12.04,6.09,11]dodecane (PubChem CID 99954925) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (3R,4S,6R,7S,8S,9S,11S,12S)-5,10-dioxahexacyclo[6.4.0.02,7.03,12.04,6.09,11]dodecane.
| Compound Name | (3R,4S,6R,7S,8S,9S,11S,12S)-5,10-dioxahexacyclo[6.4.0.02,7.03,12.04,6.09,11]dodecane |
|---|---|
| PubChem CID | 99954925 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (3R,4S,6R,7S,8S,9S,11S,12S)-5,10-dioxahexacyclo[6.4.0.02,7.03,12.04,6.09,11]dodecane |
| SMILES | O1[C@@H]2[C@@H]1[C@H]1C3C4[C@H]([C@H]5O[C@H]5[C@H]41)[C@H]32 |
| InChI | InChI=1S/C10H10O2/c11-7-3-1-2-5(3)9-10(12-9)6(2)4(1)8(7)11/h1-10H/t1?,2?,3-,4-,5-,6+,7-,8-,9+,10-/m0/s1 |
| InChIKey | OQUDOZYKHIOZJM-GUUJLISDSA-N |
| XLogP | 0.27 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|