About (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane
(2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane (PubChem CID 137323682) has the molecular formula C8H8
and a molecular weight of 104.15 g/mol. Its IUPAC name is (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane.
Analyze (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane?
The IUPAC name of (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane (CID 137323682) is (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane.
What is the SMILES notation for (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane?
The canonical SMILES for (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane is C12C3C1C1C4C1C3C24.
What is the InChIKey of (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane?
The InChIKey is YIJMEXRVJPVGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8/c1-2-5(1)6-3-4(6)8(2)7(1)3/h1-8H.
What are the key properties of (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane?
(2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane has a molecular weight of 104.15 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S,8S)-pentacyclo[3.3.0.02,4.03,7.06,8]octane is sourced from PubChem (CID 137323682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).