C20H22N2O — CID 98557858
2-[(2S,3R,4R,6S,7S,9S,10R,11R,12R,14R,15S,17R)-9-(cyanomethyl)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-yl]acetonitrile (PubChem CID 98557858) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[(2S,3R,4R,6S,7S,9S,10R,11R,12R,14R,15S,17R)-9-(cyanomethyl)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-yl]acetonitrile.
| Compound Name | 2-[(2S,3R,4R,6S,7S,9S,10R,11R,12R,14R,15S,17R)-9-(cyanomethyl)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 98557858 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[(2S,3R,4R,6S,7S,9S,10R,11R,12R,14R,15S,17R)-9-(cyanomethyl)-13-oxaheptacyclo[8.6.1.02,6.03,15.07,17.011,16.012,14]heptadecan-4-yl]acetonitrile |
| SMILES | N#CC[C@H]1C[C@H]2[C@@H]3C[C@@H](CC#N)[C@H]4[C@@H]5C6C([C@H]2[C@@H]1[C@@H]6[C@H]1O[C@@H]15)[C@@H]34 |
| InChI | InChI=1S/C20H22N2O/c21-3-1-7-5-9-10-6-8(2-4-22)12-14(10)15-13(9)11(7)17-16(15)18(12)20-19(17)23-20/h7-20H,1-2,5-6H2/t7-,8+,9-,10-,11+,12+,13+,14-,15?,16?,17-,18+,19+,20+/m0/s1 |
| InChIKey | MRCSKTQHXVZKJE-YFIGGEDTSA-N |
| XLogP | 2.84 |
| TPSA | 60.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|