About 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile
2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile (PubChem CID 165452248) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile |
| PubChem CID | 165452248 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile |
| SMILES | N#CCC1CC2CC1C1CC21 |
| InChI | InChI=1S/C10H13N/c11-2-1-6-3-7-4-8(6)10-5-9(7)10/h6-10H,1,3-5H2 |
| InChIKey | UNCFZYRJECEUCY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile?
The IUPAC name of 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile (CID 165452248) is 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile.
What is the SMILES notation for 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile?
The canonical SMILES for 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile is N#CCC1CC2CC1C1CC21.
What is the InChIKey of 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile?
The InChIKey is UNCFZYRJECEUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c11-2-1-6-3-7-4-8(6)10-5-9(7)10/h6-10H,1,3-5H2.
What are the key properties of 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile?
2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile has a molecular weight of 147.22 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile is sourced from PubChem (CID 165452248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).