C10H13N — CID 165452248
2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile (PubChem CID 165452248) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile.
| Compound Name | 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile |
|---|---|
| PubChem CID | 165452248 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2-(6-tricyclo[3.2.1.02,4]octanyl)acetonitrile |
| SMILES | N#CCC1CC2CC1C1CC21 |
| InChI | InChI=1S/C10H13N/c11-2-1-6-3-7-4-8(6)10-5-9(7)10/h6-10H,1,3-5H2 |
| InChIKey | UNCFZYRJECEUCY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |