C9H13N — CID 131851939
2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetonitrile (PubChem CID 131851939) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetonitrile.
| Compound Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetonitrile |
|---|---|
| PubChem CID | 131851939 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetonitrile |
| SMILES | N#CC[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C9H13N/c10-4-3-9-6-7-1-2-8(9)5-7/h7-9H,1-3,5-6H2/t7-,8+,9+/m0/s1 |
| InChIKey | KZBGLYZJWBLKLA-DJLDLDEBSA-N |
| XLogP | 2.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |