C8H11N — CID 10964478
(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonitrile (PubChem CID 10964478) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonitrile.
| Compound Name | (1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonitrile |
|---|---|
| PubChem CID | 10964478 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (1R,2S,4S)-bicyclo[2.2.1]heptane-2-carbonitrile |
| SMILES | N#C[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C8H11N/c9-5-8-4-6-1-2-7(8)3-6/h6-8H,1-4H2/t6-,7+,8+/m0/s1 |
| InChIKey | GAHKEUUHTHVKEA-XLPZGREQSA-N |
| XLogP | 1.95 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |