(1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid

C8H8O3 — CID 99722561

IUPAC(1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid
SMILESO=C(O)[C@@H]1[C@@H]2[C@@H]3C[C@@H]1C(=O)[C@@H]32
InChIInChI=1S/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11)/t2-,3-,4+,5-,6-/m0/s1
InChIKeyYUOZAHBGIJALKD-QYESYBIKSA-N
MW152.15 g/mol
LogP0.15
Rot. Bonds1

About (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid

(1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid (PubChem CID 99722561) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid.

Molecular Properties

Compound Name(1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid
PubChem CID99722561
Molecular FormulaC8H8O3
Molecular Weight152.15 g/mol
Exact Mass152.05
IUPAC Name(1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid
SMILESO=C(O)[C@@H]1[C@@H]2[C@@H]3C[C@@H]1C(=O)[C@@H]32
InChIInChI=1S/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11)/t2-,3-,4+,5-,6-/m0/s1
InChIKeyYUOZAHBGIJALKD-QYESYBIKSA-N
XLogP0.15
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.15
LogP ≤ 50.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
The IUPAC name of (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid (CID 99722561) is (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid.
What is the SMILES notation for (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
The canonical SMILES for (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid is O=C(O)[C@@H]1[C@@H]2[C@@H]3C[C@@H]1C(=O)[C@@H]32.
What is the InChIKey of (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
The InChIKey is YUOZAHBGIJALKD-QYESYBIKSA-N. The full InChI is InChI=1S/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11)/t2-,3-,4+,5-,6-/m0/s1.
What are the key properties of (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid?
(1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid has a molecular weight of 152.15 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R,3R,4S,6S)-5-oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid is sourced from PubChem (CID 99722561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).