C10H12O — CID 130038201
tricyclo[5.3.0.02,6]dec-8-en-3-one (PubChem CID 130038201) has the molecular formula C10H12O and a molecular weight of 148.21 g/mol. Its IUPAC name is tricyclo[5.3.0.02,6]dec-8-en-3-one.
| Compound Name | tricyclo[5.3.0.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 130038201 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | tricyclo[5.3.0.02,6]dec-8-en-3-one |
| SMILES | O=C1CCC2C3C=CCC3C12 |
| InChI | InChI=1S/C10H12O/c11-9-5-4-8-6-2-1-3-7(6)10(8)9/h1-2,6-8,10H,3-5H2 |
| InChIKey | AEJSVSKOMJDXAJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|