C15H25NO — CID 10776147
8-(diethylamino)-4-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 10776147) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 8-(diethylamino)-4-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | 8-(diethylamino)-4-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10776147 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 8-(diethylamino)-4-methyl-3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | CCN(CC)C1C=CCC2C(C)CCC(=O)C21 |
| InChI | InChI=1S/C15H25NO/c1-4-16(5-2)13-8-6-7-12-11(3)9-10-14(17)15(12)13/h6,8,11-13,15H,4-5,7,9-10H2,1-3H3 |
| InChIKey | RVJZFAITWYHPOD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|