C12H16O2 — CID 102009345
(4aS,5S,8aS)-5-ethyl-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione (PubChem CID 102009345) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (4aS,5S,8aS)-5-ethyl-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione.
| Compound Name | (4aS,5S,8aS)-5-ethyl-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 102009345 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (4aS,5S,8aS)-5-ethyl-2,3,4a,5,8,8a-hexahydronaphthalene-1,4-dione |
| SMILES | CC[C@H]1C=CC[C@@H]2C(=O)CCC(=O)[C@@H]12 |
| InChI | InChI=1S/C12H16O2/c1-2-8-4-3-5-9-10(13)6-7-11(14)12(8)9/h3-4,8-9,12H,2,5-7H2,1H3/t8-,9+,12-/m0/s1 |
| InChIKey | ANTFAVOXZHXRFZ-SBMIAAHKSA-N |
| XLogP | 2.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|