C20H28N2O3 — CID 11892472
2-[(3aR,4R,7aR)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 11892472) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[(3aR,4R,7aR)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[(3aR,4R,7aR)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 11892472 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[(3aR,4R,7aR)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | CC[C@@H]1C=CC[C@H]2C(=O)N(CC(=O)NCCC3=CCCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H28N2O3/c1-2-15-9-6-10-16-18(15)20(25)22(19(16)24)13-17(23)21-12-11-14-7-4-3-5-8-14/h6-7,9,15-16,18H,2-5,8,10-13H2,1H3,(H,21,23)/t15-,16-,18-/m1/s1 |
| InChIKey | QWKLYNADIXKFRP-JFIYKMOQSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|