C14H19NO4 — CID 124761876
4-[(3aS,4R,7aS)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoic acid (PubChem CID 124761876) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-[(3aS,4R,7aS)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoic acid.
| Compound Name | 4-[(3aS,4R,7aS)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 124761876 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-[(3aS,4R,7aS)-4-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoic acid |
| SMILES | CC[C@@H]1C=CC[C@@H]2C(=O)N(CCCC(=O)O)C(=O)[C@H]21 |
| InChI | InChI=1S/C14H19NO4/c1-2-9-5-3-6-10-12(9)14(19)15(13(10)18)8-4-7-11(16)17/h3,5,9-10,12H,2,4,6-8H2,1H3,(H,16,17)/t9-,10+,12+/m1/s1 |
| InChIKey | SLAQTBMRVJUFIJ-SCVCMEIPSA-N |
| XLogP | 1.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|