C18H26NO5P — CID 71485311
(3aR,4R,7aS)-4-diethoxyphosphoryl-2-hex-5-ynyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 71485311) has the molecular formula C18H26NO5P and a molecular weight of 367.38 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-diethoxyphosphoryl-2-hex-5-ynyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7aS)-4-diethoxyphosphoryl-2-hex-5-ynyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 71485311 |
| Molecular Formula | C18H26NO5P |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3aR,4R,7aS)-4-diethoxyphosphoryl-2-hex-5-ynyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C#CCCCCN1C(=O)[C@H]2[C@H](CC=C[C@H]2P(=O)(OCC)OCC)C1=O |
| InChI | InChI=1S/C18H26NO5P/c1-4-7-8-9-13-19-17(20)14-11-10-12-15(16(14)18(19)21)25(22,23-5-2)24-6-3/h1,10,12,14-16H,5-9,11,13H2,2-3H3/t14-,15+,16-/m0/s1 |
| InChIKey | ROBBVHLJGLXPTG-XHSDSOJGSA-N |
| XLogP | 2.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|