C14H19NO6 — CID 153353678
[(3aS,4R,7aS)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate;acetic acid (PubChem CID 153353678) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [(3aS,4R,7aS)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate;acetic acid.
| Compound Name | [(3aS,4R,7aS)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate;acetic acid |
|---|---|
| PubChem CID | 153353678 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(3aS,4R,7aS)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate;acetic acid |
| SMILES | CC(=O)O.CCN1C(=O)[C@H]2[C@H](CC=C[C@H]2OC(C)=O)C1=O |
| InChI | InChI=1S/C12H15NO4.C2H4O2/c1-3-13-11(15)8-5-4-6-9(17-7(2)14)10(8)12(13)16;1-2(3)4/h4,6,8-10H,3,5H2,1-2H3;1H3,(H,3,4)/t8-,9+,10-;/m0./s1 |
| InChIKey | XYCRRVDUGNQEPU-JYNKJOSWSA-N |
| XLogP | 0.59 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|