C17H17NO4 — CID 153353676
[(3aS,4R,7aS)-2-benzyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate (PubChem CID 153353676) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is [(3aS,4R,7aS)-2-benzyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate.
| Compound Name | [(3aS,4R,7aS)-2-benzyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate |
|---|---|
| PubChem CID | 153353676 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [(3aS,4R,7aS)-2-benzyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CC[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C17H17NO4/c1-11(19)22-14-9-5-8-13-15(14)17(21)18(16(13)20)10-12-6-3-2-4-7-12/h2-7,9,13-15H,8,10H2,1H3/t13-,14+,15-/m0/s1 |
| InChIKey | XYPCKQFRAUVUIQ-ZNMIVQPWSA-N |
| XLogP | 1.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|