C20H22O6 — CID 71745541
[(1S,4aR,9S,9aR,10R)-9,10-diacetyloxy-1,4,4a,9,9a,10-hexahydroanthracen-1-yl] acetate (PubChem CID 71745541) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is [(1S,4aR,9S,9aR,10R)-9,10-diacetyloxy-1,4,4a,9,9a,10-hexahydroanthracen-1-yl] acetate.
| Compound Name | [(1S,4aR,9S,9aR,10R)-9,10-diacetyloxy-1,4,4a,9,9a,10-hexahydroanthracen-1-yl] acetate |
|---|---|
| PubChem CID | 71745541 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(1S,4aR,9S,9aR,10R)-9,10-diacetyloxy-1,4,4a,9,9a,10-hexahydroanthracen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC[C@@H]2[C@H]1[C@H](OC(C)=O)c1ccccc1[C@@H]2OC(C)=O |
| InChI | InChI=1S/C20H22O6/c1-11(21)24-17-10-6-9-16-18(17)20(26-13(3)23)15-8-5-4-7-14(15)19(16)25-12(2)22/h4-8,10,16-20H,9H2,1-3H3/t16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | TUFLTXAUUOHRPR-UJMXGEILSA-N |
| XLogP | 3.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|