C22H28O3P+ — CID 101228382
(2'-tert-butyl-3-hydroxy-3'-phenylspiro[1,3,3a,4,7,7a-hexahydroisophosphindol-2-ium-2,1'-phosphiren-1-ium]-4-yl) acetate (PubChem CID 101228382) has the molecular formula C22H28O3P+ and a molecular weight of 371.44 g/mol. Its IUPAC name is (2'-tert-butyl-3-hydroxy-3'-phenylspiro[1,3,3a,4,7,7a-hexahydroisophosphindol-2-ium-2,1'-phosphiren-1-ium]-4-yl) acetate.
| Compound Name | (2'-tert-butyl-3-hydroxy-3'-phenylspiro[1,3,3a,4,7,7a-hexahydroisophosphindol-2-ium-2,1'-phosphiren-1-ium]-4-yl) acetate |
|---|---|
| PubChem CID | 101228382 |
| Molecular Formula | C22H28O3P+ |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2'-tert-butyl-3-hydroxy-3'-phenylspiro[1,3,3a,4,7,7a-hexahydroisophosphindol-2-ium-2,1'-phosphiren-1-ium]-4-yl) acetate |
| SMILES | CC(=O)OC1C=CCC2C[P+]3(C(c4ccccc4)=C3C(C)(C)C)C(O)C21 |
| InChI | InChI=1S/C22H28O3P/c1-14(23)25-17-12-8-11-16-13-26(21(24)18(16)17)19(20(26)22(2,3)4)15-9-6-5-7-10-15/h5-10,12,16-18,21,24H,11,13H2,1-4H3/q+1 |
| InChIKey | ANSSQMDCNGCHCD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|