C16H16O5 — CID 135045998
[(1R,4aS,9R,9aR)-8,9-dihydroxy-10-oxo-4,4a,9,9a-tetrahydro-1H-anthracen-1-yl] acetate (PubChem CID 135045998) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is [(1R,4aS,9R,9aR)-8,9-dihydroxy-10-oxo-4,4a,9,9a-tetrahydro-1H-anthracen-1-yl] acetate.
| Compound Name | [(1R,4aS,9R,9aR)-8,9-dihydroxy-10-oxo-4,4a,9,9a-tetrahydro-1H-anthracen-1-yl] acetate |
|---|---|
| PubChem CID | 135045998 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [(1R,4aS,9R,9aR)-8,9-dihydroxy-10-oxo-4,4a,9,9a-tetrahydro-1H-anthracen-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CC[C@@H]2C(=O)c3cccc(O)c3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C16H16O5/c1-8(17)21-12-7-3-5-10-14(12)16(20)13-9(15(10)19)4-2-6-11(13)18/h2-4,6-7,10,12,14,16,18,20H,5H2,1H3/t10-,12+,14-,16-/m0/s1 |
| InChIKey | SGHIINARMKQKQK-MXZCIGPVSA-N |
| XLogP | 1.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|