C12H15NO3 — CID 101192687
(3aS,5S,7aR)-5-acetyl-2-ethyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 101192687) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (3aS,5S,7aR)-5-acetyl-2-ethyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,5S,7aR)-5-acetyl-2-ethyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 101192687 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (3aS,5S,7aR)-5-acetyl-2-ethyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCN1C(=O)[C@H]2C[C@H](C(C)=O)C=C[C@H]2C1=O |
| InChI | InChI=1S/C12H15NO3/c1-3-13-11(15)9-5-4-8(7(2)14)6-10(9)12(13)16/h4-5,8-10H,3,6H2,1-2H3/t8-,9-,10+/m1/s1 |
| InChIKey | KFZFDLUITWSSEM-BBBLOLIVSA-N |
| XLogP | 0.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|