C15H17NOS — CID 11065150
(1R,3aR,4S,7aR)-4-methyl-1-(4-methylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzothiazol-3-one (PubChem CID 11065150) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-4-methyl-1-(4-methylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzothiazol-3-one.
| Compound Name | (1R,3aR,4S,7aR)-4-methyl-1-(4-methylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 11065150 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1R,3aR,4S,7aR)-4-methyl-1-(4-methylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzothiazol-3-one |
| SMILES | Cc1ccc([S@@]2=NC(=O)[C@@H]3[C@H]2CC=C[C@@H]3C)cc1 |
| InChI | InChI=1S/C15H17NOS/c1-10-6-8-12(9-7-10)18-13-5-3-4-11(2)14(13)15(17)16-18/h3-4,6-9,11,13-14H,5H2,1-2H3/t11-,13+,14-,18-/m0/s1 |
| InChIKey | FSLRRNMRFBWIMD-KTMFAHBVSA-N |
| XLogP | 3.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|