C23H24O3S — CID 10809815
(1R,4aS,9aR,10S)-10-hydroxy-1-methyl-10-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,4,4a,9a-tetrahydroanthracen-9-one (PubChem CID 10809815) has the molecular formula C23H24O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (1R,4aS,9aR,10S)-10-hydroxy-1-methyl-10-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,4,4a,9a-tetrahydroanthracen-9-one.
| Compound Name | (1R,4aS,9aR,10S)-10-hydroxy-1-methyl-10-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,4,4a,9a-tetrahydroanthracen-9-one |
|---|---|
| PubChem CID | 10809815 |
| Molecular Formula | C23H24O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (1R,4aS,9aR,10S)-10-hydroxy-1-methyl-10-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,4,4a,9a-tetrahydroanthracen-9-one |
| SMILES | Cc1ccc([S@](=O)C[C@@]2(O)c3ccccc3C(=O)[C@@H]3[C@H](C)C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C23H24O3S/c1-15-10-12-17(13-11-15)27(26)14-23(25)19-8-4-3-7-18(19)22(24)21-16(2)6-5-9-20(21)23/h3-8,10-13,16,20-21,25H,9,14H2,1-2H3/t16-,20+,21-,23-,27-/m1/s1 |
| InChIKey | ZDDBIFQYVYCINU-NCOUIPFBSA-N |
| XLogP | 4.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|