About 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one
4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one (PubChem CID 11322988) has the molecular formula C14H14O3S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one |
| PubChem CID | 11322988 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one |
| SMILES | Cc1ccc([S@@](=O)CC2(O)C=CC(=O)C=C2)cc1 |
| InChI | InChI=1S/C14H14O3S/c1-11-2-4-13(5-3-11)18(17)10-14(16)8-6-12(15)7-9-14/h2-9,16H,10H2,1H3/t18-/m0/s1 |
| InChIKey | OLOAOMFBAOPUCS-SFHVURJKSA-N |
| XLogP | 1.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one?
The IUPAC name of 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one (CID 11322988) is 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one is Cc1ccc([S@@](=O)CC2(O)C=CC(=O)C=C2)cc1.
What is the InChIKey of 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one?
The InChIKey is OLOAOMFBAOPUCS-SFHVURJKSA-N. The full InChI is InChI=1S/C14H14O3S/c1-11-2-4-13(5-3-11)18(17)10-14(16)8-6-12(15)7-9-14/h2-9,16H,10H2,1H3/t18-/m0/s1.
What are the key properties of 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one?
4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one has a molecular weight of 262.33 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-one is sourced from PubChem (CID 11322988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).